You are here: Home >> Custom Quote Request

Please leave your request below, we will respond it as soon as possible.
  ITEM#: 117 C6H10=NNHC(O)C(O)NHN=C6H10 
  F.W.: 278.36 CAS#: 370-81-0
  Specific Gravity: 0.000
  Descriptions:Cuprizone. Super sensitive reagent for the spectrophotometric determination of copper(II).
Please leave your questions, we will answer them as soon as possible.
Item#:    117
Quantity: *   
Package Request: *
(example 6x500ml or 2x20kg or 50kg drums)
Actual/budgetary purposes: *
If for budgetary purposes, a quote within a 20% range of the firm
price as we will require updates on raw material costs, labor costs,
etc. (under the need box)
Expected Delivery Date:   
Annual requirement: *
Are you an end-user or a distributor? *
What is the required grade? *
What are the required specifications? *
Into which industry and country will this material be utilized?
What is the material use?
Target Price Consideration
E-mail: *
Phone: *  extension 
First Name: *  
Last Name: *  
Facility Id: * 99999
Company Name: *  
Address: *  