You are here: Home >> Custom Quote Request

Please leave your request below, we will respond it as soon as possible.
  ITEM#: 294 C12H4N2(CH3)2(C6H4SO3Na)2 
  F.W.: 564.55 CAS#: 52698-84-7
  Specific Gravity: 0.000
  Descriptions:2,9 Dimethyl-4,7-diphenyl-1,10-phenanthroline-disulfonic Acid Disodium Salt. Reagent for the colorimetric determination of copper. For uses of this reagent see booklet No. 217.
Please leave your questions, we will answer them as soon as possible.
Item#:    294
Quantity: *   
Package Request: *
(example 6x500ml or 2x20kg or 50kg drums)
Actual/budgetary purposes: *
If for budgetary purposes, a quote within a 20% range of the firm
price as we will require updates on raw material costs, labor costs,
etc. (under the need box)
Expected Delivery Date:   
Annual requirement: *
Are you an end-user or a distributor? *
What is the required grade? *
What are the required specifications? *
Into which industry and country will this material be utilized?
What is the material use?
Target Price Consideration
E-mail: *
Phone: *  extension 
First Name: *  
Last Name: *  
Facility Id: * 99999
Company Name: *  
Address: *  